C28H21N3O5 — CID 46509472
N-[4-[[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]phenyl]furan-2-carboxamide (PubChem CID 46509472) has the molecular formula C28H21N3O5 and a molecular weight of 479.49 g/mol. Its IUPAC name is N-[4-[[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46509472 |
| Molecular Formula | C28H21N3O5 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-[4-[[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)C(Cc2ccccc2)N2C(=O)c3ccccc3C2=O)cc1)c1ccco1 |
| InChI | InChI=1S/C28H21N3O5/c32-25(29-19-12-14-20(15-13-19)30-26(33)24-11-6-16-36-24)23(17-18-7-2-1-3-8-18)31-27(34)21-9-4-5-10-22(21)28(31)35/h1-16,23H,17H2,(H,29,32)(H,30,33) |
| InChIKey | CXAYAVSHJMKNNG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|