C23H16Cl2N2O3 — CID 1189000
(2R)-N-(3,5-dichlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide (PubChem CID 1189000) has the molecular formula C23H16Cl2N2O3 and a molecular weight of 439.30 g/mol. Its IUPAC name is (2R)-N-(3,5-dichlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide.
| Compound Name | (2R)-N-(3,5-dichlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 1189000 |
| Molecular Formula | C23H16Cl2N2O3 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | (2R)-N-(3,5-dichlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)[C@@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H16Cl2N2O3/c24-15-11-16(25)13-17(12-15)26-21(28)20(10-14-6-2-1-3-7-14)27-22(29)18-8-4-5-9-19(18)23(27)30/h1-9,11-13,20H,10H2,(H,26,28)/t20-/m1/s1 |
| InChIKey | OFQLAZNDWGBCGE-HXUWFJFHSA-N |
| XLogP | 4.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|