C23H15Cl2N3O5 — CID 2902505
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(4-nitrophenyl)-3-phenylpropanamide (PubChem CID 2902505) has the molecular formula C23H15Cl2N3O5 and a molecular weight of 484.30 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(4-nitrophenyl)-3-phenylpropanamide.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(4-nitrophenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 2902505 |
| Molecular Formula | C23H15Cl2N3O5 |
| Molecular Weight | 484.30 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(4-nitrophenyl)-3-phenylpropanamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C(Cc1ccccc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C23H15Cl2N3O5/c24-18-11-16-17(12-19(18)25)23(31)27(22(16)30)20(10-13-4-2-1-3-5-13)21(29)26-14-6-8-15(9-7-14)28(32)33/h1-9,11-12,20H,10H2,(H,26,29) |
| InChIKey | FSJLNSWZBQNBIW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.30 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|