C26H21N3O7 — CID 2833970
ethyl 4-[[2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoyl]amino]benzoate (PubChem CID 2833970) has the molecular formula C26H21N3O7 and a molecular weight of 487.47 g/mol. Its IUPAC name is ethyl 4-[[2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 2833970 |
| Molecular Formula | C26H21N3O7 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | ethyl 4-[[2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(Cc2ccc([N+](=O)[O-])cc2)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H21N3O7/c1-2-36-26(33)17-9-11-18(12-10-17)27-23(30)22(15-16-7-13-19(14-8-16)29(34)35)28-24(31)20-5-3-4-6-21(20)25(28)32/h3-14,22H,2,15H2,1H3,(H,27,30) |
| InChIKey | NIDRNMFMUSRRSQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|