C20H20N2O6 — CID 143263161
ethane;methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoate (PubChem CID 143263161) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is ethane;methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoate.
| Compound Name | ethane;methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 143263161 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | ethane;methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanoate |
| SMILES | CC.COC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14N2O6.C2H6/c1-26-18(23)15(10-11-6-8-12(9-7-11)20(24)25)19-16(21)13-4-2-3-5-14(13)17(19)22;1-2/h2-9,15H,10H2,1H3;1-2H3/t15-;/m0./s1 |
| InChIKey | JLRNOSRBNBBVCR-RSAXXLAASA-N |
| XLogP | 3.00 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|