C27H24BrN3O5 — CID 1246802
(2S)-N-[(1R)-1-[4-(2-bromoethyl)phenyl]ethyl]-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanamide (PubChem CID 1246802) has the molecular formula C27H24BrN3O5 and a molecular weight of 550.41 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-[4-(2-bromoethyl)phenyl]ethyl]-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanamide.
| Compound Name | (2S)-N-[(1R)-1-[4-(2-bromoethyl)phenyl]ethyl]-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 1246802 |
| Molecular Formula | C27H24BrN3O5 |
| Molecular Weight | 550.41 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | (2S)-N-[(1R)-1-[4-(2-bromoethyl)phenyl]ethyl]-2-(1,3-dioxoisoindol-2-yl)-3-(4-nitrophenyl)propanamide |
| SMILES | C[C@@H](NC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)N1C(=O)c2ccccc2C1=O)c1ccc(CCBr)cc1 |
| InChI | InChI=1S/C27H24BrN3O5/c1-17(20-10-6-18(7-11-20)14-15-28)29-25(32)24(16-19-8-12-21(13-9-19)31(35)36)30-26(33)22-4-2-3-5-23(22)27(30)34/h2-13,17,24H,14-16H2,1H3,(H,29,32)/t17-,24+/m1/s1 |
| InChIKey | PMNOEDMNIDHMOB-OSPHWJPCSA-N |
| XLogP | 4.62 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|