C17H12ClNO3 — CID 42325650
(2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl chloride (PubChem CID 42325650) has the molecular formula C17H12ClNO3 and a molecular weight of 313.74 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl chloride.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl chloride |
|---|---|
| PubChem CID | 42325650 |
| Molecular Formula | C17H12ClNO3 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl chloride |
| SMILES | O=C(Cl)[C@@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H12ClNO3/c18-15(20)14(10-11-6-2-1-3-7-11)19-16(21)12-8-4-5-9-13(12)17(19)22/h1-9,14H,10H2/t14-/m1/s1 |
| InChIKey | SXIUZIQEYOOHEP-CQSZACIVSA-N |
| XLogP | 2.66 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|