C17H12NO4- — CID 6919275
(2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 6919275) has the molecular formula C17H12NO4- and a molecular weight of 294.29 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 6919275 |
| Molecular Formula | C17H12NO4- |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | O=C([O-])[C@@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H13NO4/c19-15-12-8-4-5-9-13(12)16(20)18(15)14(17(21)22)10-11-6-2-1-3-7-11/h1-9,14H,10H2,(H,21,22)/p-1/t14-/m1/s1 |
| InChIKey | VAYRSTHMTWUHGE-CQSZACIVSA-M |
| XLogP | 0.64 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|