C17H11N2O6- — CID 6939472
(2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 6939472) has the molecular formula C17H11N2O6- and a molecular weight of 339.28 g/mol. Its IUPAC name is (2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | (2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 6939472 |
| Molecular Formula | C17H11N2O6- |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | (2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | O=C([O-])[C@H](Cc1ccccc1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C17H12N2O6/c20-15-11-7-4-8-12(19(24)25)14(11)16(21)18(15)13(17(22)23)9-10-5-2-1-3-6-10/h1-8,13H,9H2,(H,22,23)/p-1/t13-/m0/s1 |
| InChIKey | DHPPYFBMYUEKJC-ZDUSSCGKSA-M |
| XLogP | 0.55 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|