C17H11LiN2O6 — CID 24940974
lithium 2-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 24940974) has the molecular formula C17H11LiN2O6 and a molecular weight of 346.22 g/mol. Its IUPAC name is lithium 2-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | lithium 2-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 24940974 |
| Molecular Formula | C17H11LiN2O6 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | lithium 2-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | O=C([O-])C(Cc1ccccc1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O.[Li+] |
| InChI | InChI=1S/C17H12N2O6.Li/c20-15-11-7-4-8-12(19(24)25)14(11)16(21)18(15)13(17(22)23)9-10-5-2-1-3-6-10;/h1-8,13H,9H2,(H,22,23);/q;+1/p-1 |
| InChIKey | MTYMODKZWAXESM-UHFFFAOYSA-M |
| XLogP | -2.44 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|