C21H17ClN2O9S — CID 126187422
[2-(2-chlorophenyl)-2-oxoethyl] (2R)-4-methylsulfonyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 126187422) has the molecular formula C21H17ClN2O9S and a molecular weight of 508.89 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-2-oxoethyl] (2R)-4-methylsulfonyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [2-(2-chlorophenyl)-2-oxoethyl] (2R)-4-methylsulfonyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 126187422 |
| Molecular Formula | C21H17ClN2O9S |
| Molecular Weight | 508.89 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | [2-(2-chlorophenyl)-2-oxoethyl] (2R)-4-methylsulfonyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CS(=O)(=O)CC[C@H](C(=O)OCC(=O)c1ccccc1Cl)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C21H17ClN2O9S/c1-34(31,32)10-9-16(21(28)33-11-17(25)12-5-2-3-7-14(12)22)23-19(26)13-6-4-8-15(24(29)30)18(13)20(23)27/h2-8,16H,9-11H2,1H3/t16-/m1/s1 |
| InChIKey | XYLLNTCSRPOBDD-MRXNPFEDSA-N |
| XLogP | 2.07 |
| TPSA | 158.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.89 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|