C18H18N2O7S — CID 8625655
[2-oxo-2-(prop-2-ynylamino)ethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate (PubChem CID 8625655) has the molecular formula C18H18N2O7S and a molecular weight of 406.42 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 8625655 |
| Molecular Formula | C18H18N2O7S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
| SMILES | C#CCNC(=O)COC(=O)[C@@H](CCS(C)(=O)=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H18N2O7S/c1-3-9-19-15(21)11-27-18(24)14(8-10-28(2,25)26)20-16(22)12-6-4-5-7-13(12)17(20)23/h1,4-7,14H,8-11H2,2H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | YERSROHPYMHBHC-CQSZACIVSA-N |
| XLogP | -0.62 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|