C17H21N3O6S — CID 9224977
(2S)-2-(1,3-dioxoisoindol-2-yl)-N-[2-(ethylamino)-2-oxoethyl]-4-methylsulfonylbutanamide (PubChem CID 9224977) has the molecular formula C17H21N3O6S and a molecular weight of 395.44 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[2-(ethylamino)-2-oxoethyl]-4-methylsulfonylbutanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[2-(ethylamino)-2-oxoethyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 9224977 |
| Molecular Formula | C17H21N3O6S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[2-(ethylamino)-2-oxoethyl]-4-methylsulfonylbutanamide |
| SMILES | CCNC(=O)CNC(=O)[C@H](CCS(C)(=O)=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H21N3O6S/c1-3-18-14(21)10-19-15(22)13(8-9-27(2,25)26)20-16(23)11-6-4-5-7-12(11)17(20)24/h4-7,13H,3,8-10H2,1-2H3,(H,18,21)(H,19,22)/t13-/m0/s1 |
| InChIKey | ZVNWPXLPOJXAMB-ZDUSSCGKSA-N |
| XLogP | -0.66 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|