C25H22N2O5S — CID 24556647
N-(1,2-dihydroacenaphthylen-5-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanamide (PubChem CID 24556647) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 24556647 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-yl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCC(C(=O)Nc1ccc2c3c(cccc13)CC2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H22N2O5S/c1-33(31,32)14-13-21(27-24(29)17-6-2-3-7-18(17)25(27)30)23(28)26-20-12-11-16-10-9-15-5-4-8-19(20)22(15)16/h2-8,11-12,21H,9-10,13-14H2,1H3,(H,26,28) |
| InChIKey | HJUUAUSMQBTVOL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|