C21H21ClN2O7S — CID 24684145
N-(2-chloro-4,5-dimethoxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanamide (PubChem CID 24684145) has the molecular formula C21H21ClN2O7S and a molecular weight of 480.93 g/mol. Its IUPAC name is N-(2-chloro-4,5-dimethoxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanamide.
| Compound Name | N-(2-chloro-4,5-dimethoxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 24684145 |
| Molecular Formula | C21H21ClN2O7S |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | N-(2-chloro-4,5-dimethoxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanamide |
| SMILES | COc1cc(Cl)c(NC(=O)C(CCS(C)(=O)=O)N2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C21H21ClN2O7S/c1-30-17-10-14(22)15(11-18(17)31-2)23-19(25)16(8-9-32(3,28)29)24-20(26)12-6-4-5-7-13(12)21(24)27/h4-7,10-11,16H,8-9H2,1-3H3,(H,23,25) |
| InChIKey | OOESEKFCGSIWLU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|