C19H17ClN2O4 — CID 7788336
(2S)-N-(4-chloro-2-methoxy-5-methylphenyl)-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 7788336) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is (2S)-N-(4-chloro-2-methoxy-5-methylphenyl)-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | (2S)-N-(4-chloro-2-methoxy-5-methylphenyl)-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 7788336 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (2S)-N-(4-chloro-2-methoxy-5-methylphenyl)-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)[C@H](C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H17ClN2O4/c1-10-8-15(16(26-3)9-14(10)20)21-17(23)11(2)22-18(24)12-6-4-5-7-13(12)19(22)25/h4-9,11H,1-3H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | KXIIPMKKOIDMCG-NSHDSACASA-N |
| XLogP | 3.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|