C19H16ClN3O7 — CID 55330124
N-(4-chloro-2,5-dimethoxyphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 55330124) has the molecular formula C19H16ClN3O7 and a molecular weight of 433.80 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 55330124 |
| Molecular Formula | C19H16ClN3O7 |
| Molecular Weight | 433.80 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | COc1cc(NC(=O)C(C)N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c(OC)cc1Cl |
| InChI | InChI=1S/C19H16ClN3O7/c1-9(17(24)21-12-8-14(29-2)11(20)7-15(12)30-3)22-18(25)10-5-4-6-13(23(27)28)16(10)19(22)26/h4-9H,1-3H3,(H,21,24) |
| InChIKey | LHFDZXGEZXFKAH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.80 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|