C18H14N4O7 — CID 55363265
N-(2-methyl-3-nitrophenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 55363265) has the molecular formula C18H14N4O7 and a molecular weight of 398.33 g/mol. Its IUPAC name is N-(2-methyl-3-nitrophenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(2-methyl-3-nitrophenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 55363265 |
| Molecular Formula | C18H14N4O7 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-(2-methyl-3-nitrophenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | Cc1c(NC(=O)C(C)N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14N4O7/c1-9-12(6-4-7-13(9)21(26)27)19-16(23)10(2)20-17(24)11-5-3-8-14(22(28)29)15(11)18(20)25/h3-8,10H,1-2H3,(H,19,23) |
| InChIKey | CDMSDJVDBVYONU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|