C19H15FN4O6 — CID 55538037
N-(3-acetamido-4-fluorophenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 55538037) has the molecular formula C19H15FN4O6 and a molecular weight of 414.35 g/mol. Its IUPAC name is N-(3-acetamido-4-fluorophenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(3-acetamido-4-fluorophenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 55538037 |
| Molecular Formula | C19H15FN4O6 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-(3-acetamido-4-fluorophenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CC(=O)Nc1cc(NC(=O)C(C)N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)ccc1F |
| InChI | InChI=1S/C19H15FN4O6/c1-9(17(26)22-11-6-7-13(20)14(8-11)21-10(2)25)23-18(27)12-4-3-5-15(24(29)30)16(12)19(23)28/h3-9H,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | KNWSQCWHNGYUKU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|