C20H17N5O7 — CID 55664528
N-(2-amino-2-oxoethyl)-3-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]benzamide (PubChem CID 55664528) has the molecular formula C20H17N5O7 and a molecular weight of 439.38 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 55664528 |
| Molecular Formula | C20H17N5O7 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]benzamide |
| SMILES | CC(C(=O)Nc1cccc(C(=O)NCC(N)=O)c1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C20H17N5O7/c1-10(24-19(29)13-6-3-7-14(25(31)32)16(13)20(24)30)17(27)23-12-5-2-4-11(8-12)18(28)22-9-15(21)26/h2-8,10H,9H2,1H3,(H2,21,26)(H,22,28)(H,23,27) |
| InChIKey | YMZFVWPNNWWDHF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 181.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|