C21H20N4O8S — CID 55944611
(2S)-N-(3-morpholin-4-ylsulfonylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 55944611) has the molecular formula C21H20N4O8S and a molecular weight of 488.48 g/mol. Its IUPAC name is (2S)-N-(3-morpholin-4-ylsulfonylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | (2S)-N-(3-morpholin-4-ylsulfonylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 55944611 |
| Molecular Formula | C21H20N4O8S |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (2S)-N-(3-morpholin-4-ylsulfonylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1cccc(S(=O)(=O)N2CCOCC2)c1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C21H20N4O8S/c1-13(24-20(27)16-6-3-7-17(25(29)30)18(16)21(24)28)19(26)22-14-4-2-5-15(12-14)34(31,32)23-8-10-33-11-9-23/h2-7,12-13H,8-11H2,1H3,(H,22,26)/t13-/m0/s1 |
| InChIKey | YNSRJSPMNXSCOG-ZDUSSCGKSA-N |
| XLogP | 1.24 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|