C21H23N3O9S — CID 42969797
[1-(3-morpholin-4-ylsulfonylanilino)-1-oxopropan-2-yl] 2-(2-nitrophenoxy)acetate (PubChem CID 42969797) has the molecular formula C21H23N3O9S and a molecular weight of 493.49 g/mol. Its IUPAC name is [1-(3-morpholin-4-ylsulfonylanilino)-1-oxopropan-2-yl] 2-(2-nitrophenoxy)acetate.
| Compound Name | [1-(3-morpholin-4-ylsulfonylanilino)-1-oxopropan-2-yl] 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 42969797 |
| Molecular Formula | C21H23N3O9S |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | [1-(3-morpholin-4-ylsulfonylanilino)-1-oxopropan-2-yl] 2-(2-nitrophenoxy)acetate |
| SMILES | CC(OC(=O)COc1ccccc1[N+](=O)[O-])C(=O)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H23N3O9S/c1-15(33-20(25)14-32-19-8-3-2-7-18(19)24(27)28)21(26)22-16-5-4-6-17(13-16)34(29,30)23-9-11-31-12-10-23/h2-8,13,15H,9-12,14H2,1H3,(H,22,26) |
| InChIKey | AGLIEBWMXUTVMO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|