C18H11F2N3O7 — CID 35544057
(2S)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 35544057) has the molecular formula C18H11F2N3O7 and a molecular weight of 419.30 g/mol. Its IUPAC name is (2S)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | (2S)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 35544057 |
| Molecular Formula | C18H11F2N3O7 |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | (2S)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc2c(c1)OC(F)(F)O2)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C18H11F2N3O7/c1-8(15(24)21-9-5-6-12-13(7-9)30-18(19,20)29-12)22-16(25)10-3-2-4-11(23(27)28)14(10)17(22)26/h2-8H,1H3,(H,21,24)/t8-/m0/s1 |
| InChIKey | POAIHXVYTJRTRW-QMMMGPOBSA-N |
| XLogP | 2.54 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|