C20H14N4O5 — CID 55942964
(2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-quinolin-2-ylpropanamide (PubChem CID 55942964) has the molecular formula C20H14N4O5 and a molecular weight of 390.36 g/mol. Its IUPAC name is (2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-quinolin-2-ylpropanamide.
| Compound Name | (2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-quinolin-2-ylpropanamide |
|---|---|
| PubChem CID | 55942964 |
| Molecular Formula | C20H14N4O5 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-quinolin-2-ylpropanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc2ccccc2n1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C20H14N4O5/c1-11(18(25)22-16-10-9-12-5-2-3-7-14(12)21-16)23-19(26)13-6-4-8-15(24(28)29)17(13)20(23)27/h2-11H,1H3,(H,21,22,25)/t11-/m0/s1 |
| InChIKey | ZTTRZNWPPHEJCI-NSHDSACASA-N |
| XLogP | 2.77 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|