C19H14F3N3O5S — CID 43043205
2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]propanamide (PubChem CID 43043205) has the molecular formula C19H14F3N3O5S and a molecular weight of 453.40 g/mol. Its IUPAC name is 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]propanamide.
| Compound Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]propanamide |
|---|---|
| PubChem CID | 43043205 |
| Molecular Formula | C19H14F3N3O5S |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccccc1SCC(F)(F)F)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C19H14F3N3O5S/c1-10(16(26)23-12-6-2-3-8-14(12)31-9-19(20,21)22)24-17(27)11-5-4-7-13(25(29)30)15(11)18(24)28/h2-8,10H,9H2,1H3,(H,23,26) |
| InChIKey | DNOWOZPPWBIQDW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|