C22H19ClN4O6 — CID 55727456
N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 55727456) has the molecular formula C22H19ClN4O6 and a molecular weight of 470.87 g/mol. Its IUPAC name is N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 55727456 |
| Molecular Formula | C22H19ClN4O6 |
| Molecular Weight | 470.87 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CC(C(=O)Nc1cc(Cl)ccc1C(=O)N1CCCC1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C22H19ClN4O6/c1-12(26-21(30)15-5-4-6-17(27(32)33)18(15)22(26)31)19(28)24-16-11-13(23)7-8-14(16)20(29)25-9-2-3-10-25/h4-8,11-12H,2-3,9-10H2,1H3,(H,24,28) |
| InChIKey | HFYJFVMZQPTAMK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|