C24H17ClN4O6 — CID 55936216
N-(4-chlorophenyl)-2-[[(2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyl]amino]benzamide (PubChem CID 55936216) has the molecular formula C24H17ClN4O6 and a molecular weight of 492.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[(2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyl]amino]benzamide.
| Compound Name | N-(4-chlorophenyl)-2-[[(2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 55936216 |
| Molecular Formula | C24H17ClN4O6 |
| Molecular Weight | 492.88 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[(2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyl]amino]benzamide |
| SMILES | C[C@@H](C(=O)Nc1ccccc1C(=O)Nc1ccc(Cl)cc1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C24H17ClN4O6/c1-13(28-23(32)17-6-4-8-19(29(34)35)20(17)24(28)33)21(30)27-18-7-3-2-5-16(18)22(31)26-15-11-9-14(25)10-12-15/h2-13H,1H3,(H,26,31)(H,27,30)/t13-/m0/s1 |
| InChIKey | NHDYOGLLJHUREG-ZDUSSCGKSA-N |
| XLogP | 4.12 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|