C25H17ClN4O5 — CID 55727135
N-[3-chloro-4-[cyano(phenyl)methyl]phenyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 55727135) has the molecular formula C25H17ClN4O5 and a molecular weight of 488.89 g/mol. Its IUPAC name is N-[3-chloro-4-[cyano(phenyl)methyl]phenyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[3-chloro-4-[cyano(phenyl)methyl]phenyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 55727135 |
| Molecular Formula | C25H17ClN4O5 |
| Molecular Weight | 488.89 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | N-[3-chloro-4-[cyano(phenyl)methyl]phenyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(C(C#N)c2ccccc2)c(Cl)c1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C25H17ClN4O5/c1-14(29-24(32)18-8-5-9-21(30(34)35)22(18)25(29)33)23(31)28-16-10-11-17(20(26)12-16)19(13-27)15-6-3-2-4-7-15/h2-12,14,19H,1H3,(H,28,31) |
| InChIKey | QWCLUHZVURZFKW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|