C23H15N3O5S — CID 43050066
2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[3-(2-thiophen-2-ylethynyl)phenyl]propanamide (PubChem CID 43050066) has the molecular formula C23H15N3O5S and a molecular weight of 445.46 g/mol. Its IUPAC name is 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[3-(2-thiophen-2-ylethynyl)phenyl]propanamide.
| Compound Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[3-(2-thiophen-2-ylethynyl)phenyl]propanamide |
|---|---|
| PubChem CID | 43050066 |
| Molecular Formula | C23H15N3O5S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[3-(2-thiophen-2-ylethynyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1cccc(C#Cc2cccs2)c1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C23H15N3O5S/c1-14(25-22(28)18-8-3-9-19(26(30)31)20(18)23(25)29)21(27)24-16-6-2-5-15(13-16)10-11-17-7-4-12-32-17/h2-9,12-14H,1H3,(H,24,27) |
| InChIKey | ZBAMFILCJHEIIT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|