C23H20N4O5S — CID 55341102
2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 55341102) has the molecular formula C23H20N4O5S and a molecular weight of 464.50 g/mol. Its IUPAC name is 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 55341102 |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)C(C)N3C(=O)c4cccc([N+](=O)[O-])c4C3=O)n2)cc1C |
| InChI | InChI=1S/C23H20N4O5S/c1-11-8-13(3)16(9-12(11)2)17-10-33-23(24-17)25-20(28)14(4)26-21(29)15-6-5-7-18(27(31)32)19(15)22(26)30/h5-10,14H,1-4H3,(H,24,25,28) |
| InChIKey | TXDJKJHHXWKHLY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|