C19H17N3O7S — CID 55515276
methyl 3-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]-3-thiophen-2-ylpropanoate (PubChem CID 55515276) has the molecular formula C19H17N3O7S and a molecular weight of 431.43 g/mol. Its IUPAC name is methyl 3-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 55515276 |
| Molecular Formula | C19H17N3O7S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | methyl 3-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)CC(NC(=O)C(C)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O)c1cccs1 |
| InChI | InChI=1S/C19H17N3O7S/c1-10(17(24)20-12(9-15(23)29-2)14-7-4-8-30-14)21-18(25)11-5-3-6-13(22(27)28)16(11)19(21)26/h3-8,10,12H,9H2,1-2H3,(H,20,24) |
| InChIKey | DAGRGMRNBJXFIK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|