C23H22ClN3O7 — CID 43041002
propan-2-yl 3-(2-chlorophenyl)-3-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]propanoate (PubChem CID 43041002) has the molecular formula C23H22ClN3O7 and a molecular weight of 487.90 g/mol. Its IUPAC name is propan-2-yl 3-(2-chlorophenyl)-3-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]propanoate.
| Compound Name | propan-2-yl 3-(2-chlorophenyl)-3-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]propanoate |
|---|---|
| PubChem CID | 43041002 |
| Molecular Formula | C23H22ClN3O7 |
| Molecular Weight | 487.90 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | propan-2-yl 3-(2-chlorophenyl)-3-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)C(C)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H22ClN3O7/c1-12(2)34-19(28)11-17(14-7-4-5-9-16(14)24)25-21(29)13(3)26-22(30)15-8-6-10-18(27(32)33)20(15)23(26)31/h4-10,12-13,17H,11H2,1-3H3,(H,25,29) |
| InChIKey | GINSPHGHJGOQTN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.90 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|