C21H20N4O7S — CID 4015126
2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 4015126) has the molecular formula C21H20N4O7S and a molecular weight of 472.48 g/mol. Its IUPAC name is 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 4015126 |
| Molecular Formula | C21H20N4O7S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C21H20N4O7S/c26-18(13-24-20(27)16-8-5-9-17(25(29)30)19(16)21(24)28)22-14-6-4-7-15(12-14)33(31,32)23-10-2-1-3-11-23/h4-9,12H,1-3,10-11,13H2,(H,22,26) |
| InChIKey | MEWLXHGIGPREFD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|