C22H22N4O7S — CID 4273117
N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 4273117) has the molecular formula C22H22N4O7S and a molecular weight of 486.51 g/mol. Its IUPAC name is N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 4273117 |
| Molecular Formula | C22H22N4O7S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H22N4O7S/c1-14-8-9-15(12-18(14)34(32,33)24-10-3-2-4-11-24)23-19(27)13-25-21(28)16-6-5-7-17(26(30)31)20(16)22(25)29/h5-9,12H,2-4,10-11,13H2,1H3,(H,23,27) |
| InChIKey | YZVLZBAHHVYPCS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|