C21H20N2O7S — CID 1288394
(4-acetamidophenyl) (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate (PubChem CID 1288394) has the molecular formula C21H20N2O7S and a molecular weight of 444.47 g/mol. Its IUPAC name is (4-acetamidophenyl) (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate.
| Compound Name | (4-acetamidophenyl) (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 1288394 |
| Molecular Formula | C21H20N2O7S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (4-acetamidophenyl) (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
| SMILES | CC(=O)Nc1ccc(OC(=O)[C@H](CCS(C)(=O)=O)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H20N2O7S/c1-13(24)22-14-7-9-15(10-8-14)30-21(27)18(11-12-31(2,28)29)23-19(25)16-5-3-4-6-17(16)20(23)26/h3-10,18H,11-12H2,1-2H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | RRGWYJLNLPOGGR-SFHVURJKSA-N |
| XLogP | 1.65 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|