C20H18N6O5S — CID 26705757
(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonyl-N-[4-(tetrazol-1-yl)phenyl]butanamide (PubChem CID 26705757) has the molecular formula C20H18N6O5S and a molecular weight of 454.47 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonyl-N-[4-(tetrazol-1-yl)phenyl]butanamide.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonyl-N-[4-(tetrazol-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 26705757 |
| Molecular Formula | C20H18N6O5S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonyl-N-[4-(tetrazol-1-yl)phenyl]butanamide |
| SMILES | CS(=O)(=O)CC[C@H](C(=O)Nc1ccc(-n2cnnn2)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H18N6O5S/c1-32(30,31)11-10-17(26-19(28)15-4-2-3-5-16(15)20(26)29)18(27)22-13-6-8-14(9-7-13)25-12-21-23-24-25/h2-9,12,17H,10-11H2,1H3,(H,22,27)/t17-/m1/s1 |
| InChIKey | MJFRPWVXCZQTOP-QGZVFWFLSA-N |
| XLogP | 0.70 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|