C25H30N4O5S — CID 24535373
2-(1,3-dioxoisoindol-2-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-methylsulfonylbutanamide (PubChem CID 24535373) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-methylsulfonylbutanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 24535373 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-methylsulfonylbutanamide |
| SMILES | Cc1cc(NC(=O)C(CCS(C)(=O)=O)N2C(=O)c3ccccc3C2=O)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C25H30N4O5S/c1-17-16-18(8-9-21(17)28-13-11-27(2)12-14-28)26-23(30)22(10-15-35(3,33)34)29-24(31)19-6-4-5-7-20(19)25(29)32/h4-9,16,22H,10-15H2,1-3H3,(H,26,30) |
| InChIKey | WDYKXYBVUDEVCR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|