C16H26N4O3S — CID 47928009
2-(methanesulfonamido)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]propanamide (PubChem CID 47928009) has the molecular formula C16H26N4O3S and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-(methanesulfonamido)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]propanamide.
| Compound Name | 2-(methanesulfonamido)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 47928009 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-(methanesulfonamido)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]propanamide |
| SMILES | Cc1cc(NC(=O)C(C)NS(C)(=O)=O)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C16H26N4O3S/c1-12-11-14(17-16(21)13(2)18-24(4,22)23)5-6-15(12)20-9-7-19(3)8-10-20/h5-6,11,13,18H,7-10H2,1-4H3,(H,17,21) |
| InChIKey | NBQPVDXOYMDYGA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|