C25H34N4O2 — CID 134016340
4-methyl-N-[3-methyl-1-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-1-oxobutan-2-yl]benzamide (PubChem CID 134016340) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-methyl-N-[3-methyl-1-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-methyl-N-[3-methyl-1-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 134016340 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 4-methyl-N-[3-methyl-1-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(C(=O)Nc2ccc(N3CCN(C)CC3)c(C)c2)C(C)C)cc1 |
| InChI | InChI=1S/C25H34N4O2/c1-17(2)23(27-24(30)20-8-6-18(3)7-9-20)25(31)26-21-10-11-22(19(4)16-21)29-14-12-28(5)13-15-29/h6-11,16-17,23H,12-15H2,1-5H3,(H,26,31)(H,27,30) |
| InChIKey | CEIVAPVXSPPQNE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|