C23H23ClN2O6 — CID 19228297
ethyl 5-chloro-4-[[2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl]amino]-2-methoxybenzoate (PubChem CID 19228297) has the molecular formula C23H23ClN2O6 and a molecular weight of 458.90 g/mol. Its IUPAC name is ethyl 5-chloro-4-[[2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl]amino]-2-methoxybenzoate.
| Compound Name | ethyl 5-chloro-4-[[2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl]amino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 19228297 |
| Molecular Formula | C23H23ClN2O6 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | ethyl 5-chloro-4-[[2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl]amino]-2-methoxybenzoate |
| SMILES | CCOC(=O)c1cc(Cl)c(NC(=O)C(C(C)C)N2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C23H23ClN2O6/c1-5-32-23(30)15-10-16(24)17(11-18(15)31-4)25-20(27)19(12(2)3)26-21(28)13-8-6-7-9-14(13)22(26)29/h6-12,19H,5H2,1-4H3,(H,25,27) |
| InChIKey | NWJMMQOZBYTAOX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|