C19H16ClFN2O3 — CID 9255789
(2S)-N-(4-chloro-2-fluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide (PubChem CID 9255789) has the molecular formula C19H16ClFN2O3 and a molecular weight of 374.80 g/mol. Its IUPAC name is (2S)-N-(4-chloro-2-fluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide.
| Compound Name | (2S)-N-(4-chloro-2-fluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 9255789 |
| Molecular Formula | C19H16ClFN2O3 |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | (2S)-N-(4-chloro-2-fluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
| SMILES | CC(C)[C@@H](C(=O)Nc1ccc(Cl)cc1F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16ClFN2O3/c1-10(2)16(17(24)22-15-8-7-11(20)9-14(15)21)23-18(25)12-5-3-4-6-13(12)19(23)26/h3-10,16H,1-2H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | SHTMRGBONZZGFP-INIZCTEOSA-N |
| XLogP | 3.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|