C20H17F3N2O3 — CID 1112265
(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[2-(trifluoromethyl)phenyl]butanamide (PubChem CID 1112265) has the molecular formula C20H17F3N2O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[2-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[2-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 1112265 |
| Molecular Formula | C20H17F3N2O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[2-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC(C)[C@@H](C(=O)Nc1ccccc1C(F)(F)F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H17F3N2O3/c1-11(2)16(25-18(27)12-7-3-4-8-13(12)19(25)28)17(26)24-15-10-6-5-9-14(15)20(21,22)23/h3-11,16H,1-2H3,(H,24,26)/t16-/m0/s1 |
| InChIKey | ZJNKJHQMNJRKGE-INIZCTEOSA-N |
| XLogP | 3.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|