C19H14F4N2O3 — CID 122378062
(2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-fluoro-N-[4-(trifluoromethyl)phenyl]butanamide (PubChem CID 122378062) has the molecular formula C19H14F4N2O3 and a molecular weight of 394.32 g/mol. Its IUPAC name is (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-fluoro-N-[4-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-fluoro-N-[4-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 122378062 |
| Molecular Formula | C19H14F4N2O3 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-fluoro-N-[4-(trifluoromethyl)phenyl]butanamide |
| SMILES | C[C@H](F)[C@@H](C(=O)Nc1ccc(C(F)(F)F)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H14F4N2O3/c1-10(20)15(25-17(27)13-4-2-3-5-14(13)18(25)28)16(26)24-12-8-6-11(7-9-12)19(21,22)23/h2-10,15H,1H3,(H,24,26)/t10-,15-/m0/s1 |
| InChIKey | AUQMBMVXIGJYLS-BONVTDFDSA-N |
| XLogP | 3.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|