C20H18F2N2O3S — CID 9138146
(2S)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide (PubChem CID 9138146) has the molecular formula C20H18F2N2O3S and a molecular weight of 404.44 g/mol. Its IUPAC name is (2S)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide.
| Compound Name | (2S)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 9138146 |
| Molecular Formula | C20H18F2N2O3S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (2S)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
| SMILES | CC(C)[C@@H](C(=O)Nc1ccc(SC(F)F)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H18F2N2O3S/c1-11(2)16(24-18(26)14-5-3-4-6-15(14)19(24)27)17(25)23-12-7-9-13(10-8-12)28-20(21)22/h3-11,16,20H,1-2H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | DGKCDMJWPULLCS-INIZCTEOSA-N |
| XLogP | 4.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|