C22H22N2O5 — CID 119252450
3-[4-[[2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl]amino]phenyl]propanoic acid (PubChem CID 119252450) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-[4-[[2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[[2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 119252450 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-[4-[[2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl]amino]phenyl]propanoic acid |
| SMILES | CC(C)C(C(=O)Nc1ccc(CCC(=O)O)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H22N2O5/c1-13(2)19(24-21(28)16-5-3-4-6-17(16)22(24)29)20(27)23-15-10-7-14(8-11-15)9-12-18(25)26/h3-8,10-11,13,19H,9,12H2,1-2H3,(H,23,27)(H,25,26) |
| InChIKey | DAPJNINKMOJWAS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|