C26H31N3O3 — CID 108760668
2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]butanamide (PubChem CID 108760668) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]butanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 108760668 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]butanamide |
| SMILES | CC1CCN(Cc2ccc(NC(=O)C(C(C)C)N3C(=O)c4ccccc4C3=O)cc2)CC1 |
| InChI | InChI=1S/C26H31N3O3/c1-17(2)23(29-25(31)21-6-4-5-7-22(21)26(29)32)24(30)27-20-10-8-19(9-11-20)16-28-14-12-18(3)13-15-28/h4-11,17-18,23H,12-16H2,1-3H3,(H,27,30) |
| InChIKey | XLFHOOGYTKVOFD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|