C22H23N3O4 — CID 55784633
N-(3-acetamido-4-methylphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide (PubChem CID 55784633) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-(3-acetamido-4-methylphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide.
| Compound Name | N-(3-acetamido-4-methylphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 55784633 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-(3-acetamido-4-methylphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
| SMILES | CC(=O)Nc1cc(NC(=O)C(C(C)C)N2C(=O)c3ccccc3C2=O)ccc1C |
| InChI | InChI=1S/C22H23N3O4/c1-12(2)19(25-21(28)16-7-5-6-8-17(16)22(25)29)20(27)24-15-10-9-13(3)18(11-15)23-14(4)26/h5-12,19H,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | CLQILOZZMBRFED-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|