C21H21ClN2O4 — CID 7783028
(2S,3S)-N-(3-chloro-4-methoxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanamide (PubChem CID 7783028) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is (2S,3S)-N-(3-chloro-4-methoxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanamide.
| Compound Name | (2S,3S)-N-(3-chloro-4-methoxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanamide |
|---|---|
| PubChem CID | 7783028 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (2S,3S)-N-(3-chloro-4-methoxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@@H](C(=O)Nc1ccc(OC)c(Cl)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H21ClN2O4/c1-4-12(2)18(19(25)23-13-9-10-17(28-3)16(22)11-13)24-20(26)14-7-5-6-8-15(14)21(24)27/h5-12,18H,4H2,1-3H3,(H,23,25)/t12-,18-/m0/s1 |
| InChIKey | CKZNMQXJJPMMDR-SGTLLEGYSA-N |
| XLogP | 4.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|