C19H20ClNO5 — CID 8886294
[(2S)-1-(3-chloro-4-methoxyanilino)-1-oxopropan-2-yl] 2-(2-methoxyphenyl)acetate (PubChem CID 8886294) has the molecular formula C19H20ClNO5 and a molecular weight of 377.82 g/mol. Its IUPAC name is [(2S)-1-(3-chloro-4-methoxyanilino)-1-oxopropan-2-yl] 2-(2-methoxyphenyl)acetate.
| Compound Name | [(2S)-1-(3-chloro-4-methoxyanilino)-1-oxopropan-2-yl] 2-(2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8886294 |
| Molecular Formula | C19H20ClNO5 |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [(2S)-1-(3-chloro-4-methoxyanilino)-1-oxopropan-2-yl] 2-(2-methoxyphenyl)acetate |
| SMILES | COc1ccc(NC(=O)[C@H](C)OC(=O)Cc2ccccc2OC)cc1Cl |
| InChI | InChI=1S/C19H20ClNO5/c1-12(19(23)21-14-8-9-17(25-3)15(20)11-14)26-18(22)10-13-6-4-5-7-16(13)24-2/h4-9,11-12H,10H2,1-3H3,(H,21,23)/t12-/m0/s1 |
| InChIKey | FREKOEICBHWRQX-LBPRGKRZSA-N |
| XLogP | 3.47 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |