C20H23NO5 — CID 8886117
[(2R)-1-(4-ethoxyanilino)-1-oxopropan-2-yl] 2-(2-methoxyphenyl)acetate (PubChem CID 8886117) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is [(2R)-1-(4-ethoxyanilino)-1-oxopropan-2-yl] 2-(2-methoxyphenyl)acetate.
| Compound Name | [(2R)-1-(4-ethoxyanilino)-1-oxopropan-2-yl] 2-(2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8886117 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [(2R)-1-(4-ethoxyanilino)-1-oxopropan-2-yl] 2-(2-methoxyphenyl)acetate |
| SMILES | CCOc1ccc(NC(=O)[C@@H](C)OC(=O)Cc2ccccc2OC)cc1 |
| InChI | InChI=1S/C20H23NO5/c1-4-25-17-11-9-16(10-12-17)21-20(23)14(2)26-19(22)13-15-7-5-6-8-18(15)24-3/h5-12,14H,4,13H2,1-3H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | RQQFKLSOCOTVIJ-CQSZACIVSA-N |
| XLogP | 3.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |